decyl propanoate


decyl propanoate; decyl propionate; n-decyl propionate
Formula:C13H26O2; 214.35 g/mol
InChiKey:HUOYUOXEIKDMFT-UHFFFAOYSA-N
SMILES:CCCCCCCCCCOC(=O)CC
Molecular structure of decyl propanoate
Density:0.864 g/mL
Molar volume:248.1 mL/mol
Refractive index:1.429
Molecular refractive power:63.97 mL/mol

Isomers

butyl nonanoate
Molecular structure of butyl nonanoate
3-cyclohexylheptane-3,4-diol
Molecular structure of 3-cyclohexylheptane-3,4-diol
decyl propanoate
Molecular structure of decyl propanoate
ethyl undecanoate
Molecular structure of ethyl undecanoate
heptyl hexanoate
Molecular structure of heptyl hexanoate
3-methylbutyl octanoate
Molecular structure of 3-methylbutyl octanoate
methyl dodecanoate
Molecular structure of methyl dodecanoate
2-methyldodecanoic acid
Molecular structure of 2-methyldodecanoic acid
octyl isovalerate
Molecular structure of octyl isovalerate
octyl pentanoate
Molecular structure of octyl pentanoate
pentyl octanoate
Molecular structure of pentyl octanoate
propyl decanoate
Molecular structure of propyl decanoate
tridecanoic acid
Molecular structure of tridecanoic acid